(SP-5-13)-Chloro[[2,2'-[1,3-propanediylbis[(nitrilo-κN)methylidyne]]bis[4,6-bis(1,1-dimethylethyl)phenolato-κO]](2-)]iron, 95%
cas: 2148321-95-1 — see every product listed under this CAS number, including other names
(SP-5-13)-Chloro[[2,2'-[1,3-propanediylbis[(nitrilo-κN)methylidyne]]bis[4,6-bis(1,1-dimethylethyl)phenolato-κO]](2-)]iron, 95% (CAS 2148321-95-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A2020520-250mg |
| cas | 2148321-95-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 375.94 Pln | |
| Ambeed | 1g | 648.50 Pln | |
| Ambeed | 5g | 2161.50 Pln | |
| Ambeed | 25g | 5899.50 Pln | |
| BLDpharm | 250mg | 364.34 Pln | |
| BLDpharm | 1g | 636.47 Pln | |
| BLDpharm | 5g | 2119.28 Pln | |
| BLDpharm | 25g | 5790.21 Pln | |
| Chemat | 250mg | 285.20 Pln | |
| Chemat | 1g | 510.80 Pln | |
| Chemat | 5g | 1605.20 Pln | |
| Chemat | 25g | 5406.80 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2,4-ditert-butyl-6-[3-[(3,5-ditert-butyl-2-oxidophenyl)methylideneamino]propyliminomethyl]phenolate;iron(3+);chloride (CAS 2148321-95-1) is a chemical compound with the molecular formula C33H48ClFeN2O2 and a molecular weight of 596.0 g/mol. IUPAC name: 2,4-ditert-butyl-6-[3-[(3,5-ditert-butyl-2-oxidophenyl)methylideneamino]propyliminomethyl]phenolate;iron(3+);chloride. InChIKey: SASKZWYHMLOYRF-UHFFFAOYSA-K.
| Molecular formula | C33H48ClFeN2O2 |
|---|---|
| Molecular weight | 596.0 g/mol |
| IUPAC name | 2,4-ditert-butyl-6-[3-[(3,5-ditert-butyl-2-oxidophenyl)methylideneamino]propyliminomethyl]phenolate;iron(3+);chloride |
| InChIKey | SASKZWYHMLOYRF-UHFFFAOYSA-K |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)C(C)(C)C)[O-])C=NCCCN=CC2=C(C(=CC(=C2)C(C)(C)C)C(C)(C)C)[O-].[Cl-].[Fe+3] |
Computed by PubChem (NCBI)