(T-4)-[[2,2'-[(1R,2R)-1,2-Cyclohexanediylbis[(nitrilo-κN)methylidyne]]bis[4,6-bis(1,1-dimethylethyl)phenolato-κO]](2-)]zinc, 95%
cas: 351498-19-6 — see every product listed under this CAS number, including other names
(T-4)-[[2,2'-[(1R,2R)-1,2-Cyclohexanediylbis[(nitrilo-κN)methylidyne]]bis[4,6-bis(1,1-dimethylethyl)phenolato-κO]](2-)]zinc, 95% (CAS 351498-19-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg, 10g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1440858-250mg |
| cas | 351498-19-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 286.94 Pln | |
| Ambeed | 1g | 370.38 Pln | |
| Ambeed | 5g | 1071.25 Pln | |
| Ambeed | 25g | 4837.06 Pln | |
| BLDpharm | 100mg | 236.61 Pln | |
| BLDpharm | 250mg | 297.70 Pln | |
| BLDpharm | 1g | 397.66 Pln | |
| BLDpharm | 5g | 1147.40 Pln | |
| BLDpharm | 25g | 5212.63 Pln | |
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 285.20 Pln | |
| Chemat | 5g | 1058.00 Pln | |
| Chemat | 10g | 1566.80 Pln | |
| Chemat | 25g | 3246.80 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Zinc 2,4-ditert-butyl-6-[[(1R,2R)-2-[(3,5-ditert-butyl-2-oxidophenyl)methylideneamino]cyclohexyl]iminomethyl]phenolate (CAS 351498-19-6) is a chemical compound with the molecular formula C36H52N2O2Zn and a molecular weight of 610.2 g/mol. IUPAC name: zinc 2,4-ditert-butyl-6-[[(1R,2R)-2-[(3,5-ditert-butyl-2-oxidophenyl)methylideneamino]cyclohexyl]iminomethyl]phenolate. InChIKey: KMUJCMSUODEDEM-GAQUOPITSA-L.
| Molecular formula | C36H52N2O2Zn |
|---|---|
| Molecular weight | 610.2 g/mol |
| IUPAC name | zinc 2,4-ditert-butyl-6-[[(1R,2R)-2-[(3,5-ditert-butyl-2-oxidophenyl)methylideneamino]cyclohexyl]iminomethyl]phenolate |
| InChIKey | KMUJCMSUODEDEM-GAQUOPITSA-L |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)C(C)(C)C)[O-])C=N[C@@H]2CCCC[C@H]2N=CC3=C(C(=CC(=C3)C(C)(C)C)C(C)(C)C)[O-].[Zn+2] |
Computed by PubChem (NCBI)