cas: 105-61-3 — see every product listed under this CAS number, including other names
(Z)-4-Oxo-4-ureidobut-2-enoic acid, ≥95%, ≥95% (CAS 105-61-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 50g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114SVF-10g |
| cas | 105-61-3 |
| size | 10g |
| availability | 750g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 410.00 Pln | |
| Chemat | 50g | 1158.80 Pln | |
| Chemat | 250g | 3856.40 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
(Z)-4-(carbamoylamino)-4-oxobut-2-enoic acid (CAS 105-61-3) is a chemical compound with the molecular formula C5H6N2O4 and a molecular weight of 158.11 g/mol. IUPAC name: (Z)-4-(carbamoylamino)-4-oxobut-2-enoic acid. InChIKey: GWGLGTKSTGSWGQ-UPHRSURJSA-N.
| Molecular formula | C5H6N2O4 |
|---|---|
| Molecular weight | 158.11 g/mol |
| IUPAC name | (Z)-4-(carbamoylamino)-4-oxobut-2-enoic acid |
| InChIKey | GWGLGTKSTGSWGQ-UPHRSURJSA-N |
| SMILES | C(=C\C(=O)O)\C(=O)NC(=O)N |
Computed by PubChem (NCBI)