cas: 4316-56-7 — see every product listed under this CAS number, including other names
(p-Chlorophenyl)diphenylamine, 95-<97% (CAS 4316-56-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 200g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC4669-95-97-5g |
| cas | 4316-56-7 |
| size | 5g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 5g | 3574.56 Pln | |
| Hoffman Fine Chemicals | 10g | 5533.22 Pln | |
| Hoffman Fine Chemicals | 25g | 10758.44 Pln | |
| Hoffman Fine Chemicals | 50g | 17029.98 Pln | |
| Hoffman Fine Chemicals | 100g | 27065.72 Pln | |
| Hoffman Fine Chemicals | 200g | 45797.40 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
4-chloro-N,N-diphenylaniline (CAS 4316-56-7) is a chemical compound with the molecular formula C18H14ClN and a molecular weight of 279.8 g/mol. IUPAC name: 4-chloro-N,N-diphenylaniline. InChIKey: WNMSSOWUFXADRQ-UHFFFAOYSA-N.
| Molecular formula | C18H14ClN |
|---|---|
| Molecular weight | 279.8 g/mol |
| IUPAC name | 4-chloro-N,N-diphenylaniline |
| InChIKey | WNMSSOWUFXADRQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)