cas: 473257-15-7 — see every product listed under this CAS number, including other names
(trans,trans)-4-Butyl-4'-(4-ethoxy-2,3-difluorophenyl)-1,1'-bi(cyclohexane) 97% (CAS 473257-15-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A601278-250mg |
| cas | 473257-15-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 726.38 Pln | |
| Ambeed | 1g | 1850.00 Pln | |
| Ambeed | 5g | 5410.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A601278 |
1-[4-(4-butylcyclohexyl)cyclohexyl]-4-ethoxy-2,3-difluorobenzene (CAS 473257-15-7) is a chemical compound with the molecular formula C24H36F2O and a molecular weight of 378.5 g/mol. IUPAC name: 1-[4-(4-butylcyclohexyl)cyclohexyl]-4-ethoxy-2,3-difluorobenzene. InChIKey: FDNSXGJAVAUPJG-UHFFFAOYSA-N.
| Molecular formula | C24H36F2O |
|---|---|
| Molecular weight | 378.5 g/mol |
| IUPAC name | 1-[4-(4-butylcyclohexyl)cyclohexyl]-4-ethoxy-2,3-difluorobenzene |
| InChIKey | FDNSXGJAVAUPJG-UHFFFAOYSA-N |
| SMILES | CCCCC1CCC(CC1)C2CCC(CC2)C3=C(C(=C(C=C3)OCC)F)F |
Computed by PubChem (NCBI)