cas: 167465-99-8 — see every product listed under this CAS number, including other names
[(1S,3R)-3-Hydroxycyclopentyl] tert-butyl carbamate, 99%, 99% (CAS 167465-99-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AKKX-100mg |
| cas | 167465-99-8 |
| size | 100mg |
| availability | 399.07g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 500mg | 131.60 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 338.00 Pln | |
| Chemat | 10g | 477.20 Pln | |
| Chemat | 25g | 750.80 Pln | |
| Chemat | 50g | 1302.80 Pln | |
| Chemat | 100g | 2128.40 Pln | |
| Chemat | 250g | 4197.20 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(1S,3R)-3-hydroxycyclopentyl]carbamate (CAS 167465-99-8) is a chemical compound with the molecular formula C10H19NO3 and a molecular weight of 201.26 g/mol. IUPAC name: tert-butyl N-[(1S,3R)-3-hydroxycyclopentyl]carbamate. InChIKey: SBUKINULYZANSP-JGVFFNPUSA-N.
| Molecular formula | C10H19NO3 |
|---|---|
| Molecular weight | 201.26 g/mol |
| IUPAC name | tert-butyl N-[(1S,3R)-3-hydroxycyclopentyl]carbamate |
| InChIKey | SBUKINULYZANSP-JGVFFNPUSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC[C@H](C1)O |
Computed by PubChem (NCBI)