cas: 86632-33-9 — see every product listed under this CAS number, including other names
[1,1'-binaphthalene]-2,2'-diylbis(diphenylphosphine oxide), 98% (CAS 86632-33-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 250mg, 1g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F634154-5G |
| cas | 86632-33-9 |
| size | 5g |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 232.23 Pln | |
| Fluorochem | 25g | 820.56 Pln | |
| Ambeed | 5g | 325.88 Pln | |
| Ambeed | 25g | 1076.81 Pln | |
| Ambeed | 100g | 4080.56 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 155.60 Pln | |
| Chemat | 25g | 496.40 Pln | |
| Chemat | 100g | 1806.80 Pln | |
| BLDpharm | 1g | 186.63 Pln | |
| BLDpharm | 5g | 342.13 Pln | |
| BLDpharm | 25g | 1152.95 Pln | |
| BLDpharm | 100g | 4396.25 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
2-diphenylphosphoryl-1-(2-diphenylphosphorylnaphthalen-1-yl)naphthalene (CAS 86632-33-9) is a chemical compound with the molecular formula C44H32O2P2 and a molecular weight of 654.7 g/mol. IUPAC name: 2-diphenylphosphoryl-1-(2-diphenylphosphorylnaphthalen-1-yl)naphthalene. InChIKey: SEZSRPYCOMAEDL-UHFFFAOYSA-N.
| Molecular formula | C44H32O2P2 |
|---|---|
| Molecular weight | 654.7 g/mol |
| IUPAC name | 2-diphenylphosphoryl-1-(2-diphenylphosphorylnaphthalen-1-yl)naphthalene |
| InChIKey | SEZSRPYCOMAEDL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(=O)(C2=CC=CC=C2)C3=C(C4=CC=CC=C4C=C3)C5=C(C=CC6=CC=CC=C65)P(=O)(C7=CC=CC=C7)C8=CC=CC=C8 |
Computed by PubChem (NCBI)