cas: 1588769-34-9 — see every product listed under this CAS number, including other names
[1,2,4]Triazolo[1,5-a]pyridin-6-ylboronic acid 95% (CAS 1588769-34-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A146968-100mg |
| cas | 1588769-34-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 348.12 Pln | |
| Ambeed | 250mg | 515.00 Pln | |
| Ambeed | 1g | 1382.75 Pln | |
| Ambeed | 5g | 4681.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A146968 |
[1,2,4]triazolo[1,5-a]pyridin-6-ylboronic acid (CAS 1588769-34-9) is a chemical compound with the molecular formula C6H6BN3O2 and a molecular weight of 162.94 g/mol. IUPAC name: [1,2,4]triazolo[1,5-a]pyridin-6-ylboronic acid. InChIKey: RGVGNPCIAUFRFE-UHFFFAOYSA-N.
| Molecular formula | C6H6BN3O2 |
|---|---|
| Molecular weight | 162.94 g/mol |
| IUPAC name | [1,2,4]triazolo[1,5-a]pyridin-6-ylboronic acid |
| InChIKey | RGVGNPCIAUFRFE-UHFFFAOYSA-N |
| SMILES | B(C1=CN2C(=NC=N2)C=C1)(O)O |
Computed by PubChem (NCBI)