cas: 876379-83-8 — see every product listed under this CAS number, including other names
[1,2,4]Triazolo[1,5-a]pyridine-2-carboxylic acid, 97% (CAS 876379-83-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F603894-100MG |
| cas | 876379-83-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 310.33 Pln | |
| Fluorochem | 250mg | 476.93 Pln | |
| Fluorochem | 1g | 1705.67 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
[1,2,4]triazolo[1,5-a]pyridine-2-carboxylic acid (CAS 876379-83-8) is a chemical compound with the molecular formula C7H5N3O2 and a molecular weight of 163.13 g/mol. IUPAC name: [1,2,4]triazolo[1,5-a]pyridine-2-carboxylic acid. InChIKey: LBKMEMRXNQXYQP-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | [1,2,4]triazolo[1,5-a]pyridine-2-carboxylic acid |
| InChIKey | LBKMEMRXNQXYQP-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=NN2C=C1)C(=O)O |
Computed by PubChem (NCBI)