CAS 764608-47-1 appears in our catalog under these names: Mil–53(Fe), [1,4-Benzenedicarboxylato(2-)-κO1]hydroxyiron, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 100mg, 250mg.
Iron(3+);terephthalate;hydrate (CAS 764608-47-1) is a chemical compound with the molecular formula C8H6FeO5+ and a molecular weight of 237.97 g/mol. IUPAC name: iron(3+);terephthalate;hydrate. InChIKey: IFKXKZNXXSVORM-UHFFFAOYSA-L.
| Molecular formula | C8H6FeO5+ |
|---|---|
| Molecular weight | 237.97 g/mol |
| IUPAC name | iron(3+);terephthalate;hydrate |
| InChIKey | IFKXKZNXXSVORM-UHFFFAOYSA-L |
| SMILES | C1=CC(=CC=C1C(=O)[O-])C(=O)[O-].O.[Fe+3] |
Computed by PubChem (NCBI)