cas: 2415163-55-0 — see every product listed under this CAS number, including other names
[2-(tert-butoxycarbonylamino)-7-fluoro-1,3-benzothiazol-4-yl]boronic acid, 97%, 97% (CAS 2415163-55-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JPWS-100mg |
| cas | 2415163-55-0 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 222.80 Pln | |
| Chemat | 250mg | 270.80 Pln | |
| Chemat | 500mg | 405.20 Pln | |
| Chemat | 1g | 592.40 Pln | |
| Chemat | 10g | 4898.00 Pln | |
| Chemat | 25g | 9736.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
[7-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-benzothiazol-4-yl]boronic acid (CAS 2415163-55-0) is a chemical compound with the molecular formula C12H14BFN2O4S and a molecular weight of 312.13 g/mol. IUPAC name: [7-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-benzothiazol-4-yl]boronic acid. InChIKey: ZQDPDWALEXQWLI-UHFFFAOYSA-N.
| Molecular formula | C12H14BFN2O4S |
|---|---|
| Molecular weight | 312.13 g/mol |
| IUPAC name | [7-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-benzothiazol-4-yl]boronic acid |
| InChIKey | ZQDPDWALEXQWLI-UHFFFAOYSA-N |
| SMILES | B(C1=C2C(=C(C=C1)F)SC(=N2)NC(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)