cas: 849805-97-6 — see every product listed under this CAS number, including other names
[3-(3-Fluorophenoxy)phenyl]methanamine, 95% (CAS 849805-97-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 500mg, 2.5g, 25g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | JM-9331-5g |
| cas | 849805-97-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 100mg | price on request | |
| Fluorochem | 100mg | 737.26 Pln | |
| Fluorochem | 250mg | 1034.03 Pln | |
| Fluorochem | 500mg | 1596.33 Pln | |
| Fluorochem | 1g | 2033.68 Pln | |
| Fluorochem | 2.5g | 2689.70 Pln | |
| Fluorochem | 5g | 3783.06 Pln | |
| Fluorochem | 10g | 5969.79 Pln | |
| Fluorochem | 25g | 14430.35 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
[3-(3-fluorophenoxy)phenyl]methanamine (CAS 849805-97-6) is a chemical compound with the molecular formula C13H12FNO and a molecular weight of 217.24 g/mol. IUPAC name: [3-(3-fluorophenoxy)phenyl]methanamine. InChIKey: HZQRKVJTELCYRU-UHFFFAOYSA-N.
| Molecular formula | C13H12FNO |
|---|---|
| Molecular weight | 217.24 g/mol |
| IUPAC name | [3-(3-fluorophenoxy)phenyl]methanamine |
| InChIKey | HZQRKVJTELCYRU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC2=CC(=CC=C2)F)CN |
Computed by PubChem (NCBI)