cas: 1052138-95-0 — see every product listed under this CAS number, including other names
[3-(4-Bromo-phenoxy)-propyl]-carbamic acid tert-butyl ester, 95%, 95% (CAS 1052138-95-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12NXBA-100mg |
| cas | 1052138-95-0 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1509.20 Pln | |
| Chemat | 250mg | 2349.20 Pln | |
| Chemat | 1g | 4643.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[3-(4-bromophenoxy)propyl]carbamate (CAS 1052138-95-0) is a chemical compound with the molecular formula C14H20BrNO3 and a molecular weight of 330.22 g/mol. IUPAC name: tert-butyl N-[3-(4-bromophenoxy)propyl]carbamate. InChIKey: VIBGIDFDDHXBKH-UHFFFAOYSA-N.
| Molecular formula | C14H20BrNO3 |
|---|---|
| Molecular weight | 330.22 g/mol |
| IUPAC name | tert-butyl N-[3-(4-bromophenoxy)propyl]carbamate |
| InChIKey | VIBGIDFDDHXBKH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCOC1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)