CAS 58139-59-6 appears in our catalog under these names: 2,2'–Diamino–4,4'–bithiazole, 2,2'-Diamino-4,4'-bithiazole, 2,2'-Diamino-4,4'-bithiazole, >98.0%(HPLC)(T), [4,4'-Bithiazole]-2,2'-diamine, 98%, 98%, 4,4'-bi-1,3-thiazole-2,2'-diamine, 95%. Offered by: GLPBio, Biosynth, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 50mg, 200mg, 500mg, 1000mg, 5g.
4-(2-amino-1,3-thiazol-4-yl)-1,3-thiazol-2-amine (CAS 58139-59-6) is a chemical compound with the molecular formula C6H6N4S2 and a molecular weight of 198.3 g/mol. IUPAC name: 4-(2-amino-1,3-thiazol-4-yl)-1,3-thiazol-2-amine. InChIKey: MRFMTBTUKQIBDI-UHFFFAOYSA-N.
| Molecular formula | C6H6N4S2 |
|---|---|
| Molecular weight | 198.3 g/mol |
| IUPAC name | 4-(2-amino-1,3-thiazol-4-yl)-1,3-thiazol-2-amine |
| InChIKey | MRFMTBTUKQIBDI-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(S1)N)C2=CSC(=N2)N |
Computed by PubChem (NCBI)