cas: 14353-88-9 — see every product listed under this CAS number, including other names
[Bis(trifluoroacetoxy)iodo]pentafluorobenzene, 97% (CAS 14353-88-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F009039-100MG |
| cas | 14353-88-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 159.34 Pln | |
| Fluorochem | 250mg | 200.99 Pln | |
| Fluorochem | 1g | 476.93 Pln | |
| Fluorochem | 5g | 1424.52 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
[(2,3,4,5,6-pentafluorophenyl)-(2,2,2-trifluoroacetyl)oxy-lambda3-iodanyl] 2,2,2-trifluoroacetate (CAS 14353-88-9) is a chemical compound with the molecular formula C10F11IO4 and a molecular weight of 519.99 g/mol. IUPAC name: [(2,3,4,5,6-pentafluorophenyl)-(2,2,2-trifluoroacetyl)oxy-lambda3-iodanyl] 2,2,2-trifluoroacetate. InChIKey: OQWAXRPJEPTTSZ-UHFFFAOYSA-N.
| Molecular formula | C10F11IO4 |
|---|---|
| Molecular weight | 519.99 g/mol |
| IUPAC name | [(2,3,4,5,6-pentafluorophenyl)-(2,2,2-trifluoroacetyl)oxy-lambda3-iodanyl] 2,2,2-trifluoroacetate |
| InChIKey | OQWAXRPJEPTTSZ-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)I(OC(=O)C(F)(F)F)OC(=O)C(F)(F)F)F)F)F |
Computed by PubChem (NCBI)