CAS 145-50-6 appears in our catalog under these names: p-Naphtholbenzein, 95%, alfa-Naphtholbenzein, Alpha-Naphtholbenzein (Technical Grade), a-Naphtholbenzein (Technical Grade), α–Naphtholquinonephenylmethane1–Naphtholbenzein,indicatorReag·. Offered by: Combi-blocks, Chemat Brand, TRC, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 25g, 100g, 5g, 1g, on request, 10g, 50g, 250g.
(4E)-4-[(4-hydroxynaphthalen-1-yl)-phenylmethylidene]naphthalen-1-one (CAS 145-50-6) is a chemical compound with the molecular formula C27H18O2 and a molecular weight of 374.4 g/mol. IUPAC name: (4E)-4-[(4-hydroxynaphthalen-1-yl)-phenylmethylidene]naphthalen-1-one. InChIKey: VDDWRTZCUJCDJM-SOYKGTTHSA-N.
| Molecular formula | C27H18O2 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | (4E)-4-[(4-hydroxynaphthalen-1-yl)-phenylmethylidene]naphthalen-1-one |
| InChIKey | VDDWRTZCUJCDJM-SOYKGTTHSA-N |
| SMILES | C1=CC=C(C=C1)/C(=C\2/C=CC(=O)C3=CC=CC=C23)/C4=CC=C(C5=CC=CC=C54)O |
Computed by PubChem (NCBI)