cas: 2096996-94-8 — see every product listed under this CAS number, including other names
{[4-Fluoro-2-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl}dimethylamine, HCl, 97%, 97% (CAS 2096996-94-8) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EHI2-1g |
| cas | 2096996-94-8 |
| size | 1g |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 674.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-[4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N,N-dimethylmethanamine;hydrochloride (CAS 2096996-94-8) is a chemical compound with the molecular formula C15H24BClFNO2 and a molecular weight of 315.6 g/mol. IUPAC name: 1-[4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N,N-dimethylmethanamine;hydrochloride. InChIKey: LTQBQARDAUENDI-UHFFFAOYSA-N.
| Molecular formula | C15H24BClFNO2 |
|---|---|
| Molecular weight | 315.6 g/mol |
| IUPAC name | 1-[4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N,N-dimethylmethanamine;hydrochloride |
| InChIKey | LTQBQARDAUENDI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)F)CN(C)C.Cl |
Computed by PubChem (NCBI)