cas: 1432681-06-5 — see every product listed under this CAS number, including other names
{4-((2,2,2-trifluoroethyl)amino)piperidin-4-yl}methanol dihydrochloride, 98% (CAS 1432681-06-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A845833-1g |
| cas | 1432681-06-5 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 6645.10 Pln | |
| AmBeed | 5g | 19808.32 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
[4-(2,2,2-trifluoroethylamino)piperidin-4-yl]methanol;dihydrochloride (CAS 1432681-06-5) is a chemical compound with the molecular formula C8H17Cl2F3N2O and a molecular weight of 285.13 g/mol. IUPAC name: [4-(2,2,2-trifluoroethylamino)piperidin-4-yl]methanol;dihydrochloride. InChIKey: ZOHUNVSFRRQAOY-UHFFFAOYSA-N.
| Molecular formula | C8H17Cl2F3N2O |
|---|---|
| Molecular weight | 285.13 g/mol |
| IUPAC name | [4-(2,2,2-trifluoroethylamino)piperidin-4-yl]methanol;dihydrochloride |
| InChIKey | ZOHUNVSFRRQAOY-UHFFFAOYSA-N |
| SMILES | C1CNCCC1(CO)NCC(F)(F)F.Cl.Cl |
Computed by PubChem (NCBI)