cas: 74808-10-9 — see every product listed under this CAS number, including other names
α–D–Glucopyranose, 2,3,4,6–tetraacetate (CAS 74808-10-9) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GC74123-10 |
| cas | 74808-10-9 |
| size | 10mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10mg | 639.16 Pln | |
| GLPBio | 100mg | 1491.02 Pln | |
| GLPBio | 25mg | 887.23 Pln | |
| GLPBio | 5mg | 564.28 Pln | |
| GLPBio | 50mg | 1130.62 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate (CAS 74808-10-9) is a chemical compound with the molecular formula C16H20Cl3NO10 and a molecular weight of 492.7 g/mol. IUPAC name: [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate. InChIKey: IBUZGVQIKARDAF-RKQHYHRCSA-N.
| Molecular formula | C16H20Cl3NO10 |
|---|---|
| Molecular weight | 492.7 g/mol |
| IUPAC name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
| InChIKey | IBUZGVQIKARDAF-RKQHYHRCSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)OC(=N)C(Cl)(Cl)Cl)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)