CAS 63699-78-5 appears in our catalog under these names: L-Glutamic acid gamma-(3-carboxy-4-nitroanilide) ammonium salt, 95%, γ-GT/ 98.12% (existing batch purity), γ–GT, L-Glutamic acid gamma-(3-carboxy-4-nitroanilide) ammonium salt, L-GLUTAMIC ACID G-(3-CARBOXY-4&. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: 100mg, 1g, 5g, 25mg, 50mg, 10mM (in 1ml water), 0,5g, 2g.
5-[[(4S)-4-amino-4-carboxybutanoyl]amino]-2-nitrobenzoic acid;azane (CAS 63699-78-5) is a chemical compound with the molecular formula C12H16N4O7 and a molecular weight of 328.28 g/mol. IUPAC name: 5-[[(4S)-4-amino-4-carboxybutanoyl]amino]-2-nitrobenzoic acid;azane. InChIKey: GFABNNMTRVBLPZ-QRPNPIFTSA-N.
| Molecular formula | C12H16N4O7 |
|---|---|
| Molecular weight | 328.28 g/mol |
| IUPAC name | 5-[[(4S)-4-amino-4-carboxybutanoyl]amino]-2-nitrobenzoic acid;azane |
| InChIKey | GFABNNMTRVBLPZ-QRPNPIFTSA-N |
| SMILES | C1=CC(=C(C=C1NC(=O)CC[C@@H](C(=O)O)N)C(=O)O)[N+](=O)[O-].N |
Computed by PubChem (NCBI)