1(2H)-Pyridinecarboxylic acid, 3,6-dihydro-3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, 1,1-dimethylethyl ester, 95%
cas: 1268816-61-0 — see every product listed under this CAS number, including other names
1(2H)-Pyridinecarboxylic acid, 3,6-dihydro-3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, 1,1-dimethylethyl ester, 95% (CAS 1268816-61-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F980034-100MG |
| cas | 1268816-61-0 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 346.77 Pln | |
| Fluorochem | 250mg | 549.82 Pln | |
| Fluorochem | 500mg | 940.31 Pln | |
| Fluorochem | 1g | 1382.86 Pln | |
| Fluorochem | 5g | 5449.14 Pln | |
| Fluorochem | 10g | 8349.16 Pln | |
| Fluorochem | 25g | 19740.98 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylate (CAS 1268816-61-0) is a chemical compound with the molecular formula C17H30BNO4 and a molecular weight of 323.2 g/mol. IUPAC name: tert-butyl 3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylate. InChIKey: QJCSWGSRGIUZJP-UHFFFAOYSA-N.
| Molecular formula | C17H30BNO4 |
|---|---|
| Molecular weight | 323.2 g/mol |
| IUPAC name | tert-butyl 3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylate |
| InChIKey | QJCSWGSRGIUZJP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CCN(CC2C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)