CAS 95759-44-7 appears in our catalog under these names: 1,1':4',1''-Terphenyl, 4''-ethyl-2'-fluoro-4-propyl-, 98%, 4''–Ethyl–2'–fluoro–4–propyl–1,1'：4',1''–terphenyl, 4''-Ethyl-2'-fluoro-4-propyl-1,1':4',1''-terphenyl, >98.0%(GC), 4''-Ethyl-2'-fluoro-4-propyl-1,1':4',1''-terphenyl, 98%, 98%, 1,1':4',1''-TERPHENYL, 4''-ETHYL-2'-FLUORO-4-PROPYL-, 95%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100g, 25g, 500g.
4-(4-ethylphenyl)-2-fluoro-1-(4-propylphenyl)benzene (CAS 95759-44-7) is a chemical compound with the molecular formula C23H23F and a molecular weight of 318.4 g/mol. IUPAC name: 4-(4-ethylphenyl)-2-fluoro-1-(4-propylphenyl)benzene. InChIKey: MBGFTFFIFLHYQU-UHFFFAOYSA-N.
| Molecular formula | C23H23F |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | 4-(4-ethylphenyl)-2-fluoro-1-(4-propylphenyl)benzene |
| InChIKey | MBGFTFFIFLHYQU-UHFFFAOYSA-N |
| SMILES | CCCC1=CC=C(C=C1)C2=C(C=C(C=C2)C3=CC=C(C=C3)CC)F |
Computed by PubChem (NCBI)