1,1'-(((3,3'-Dimethyl-[1,1'-biphenyl]-4,4'-diyl)bis(azanylylidene))bis(methanylylidene))bis(naphthalen-2-ol), 97%
cas: 16196-97-7 — see every product listed under this CAS number, including other names
1,1'-(((3,3'-Dimethyl-[1,1'-biphenyl]-4,4'-diyl)bis(azanylylidene))bis(methanylylidene))bis(naphthalen-2-ol), 97% (CAS 16196-97-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A194446-250mg |
| cas | 16196-97-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 164.56 Pln | |
| Ambeed | 5g | 309.19 Pln | |
| Ambeed | 10g | 420.44 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 294.80 Pln | |
| Chemat | 10g | 510.80 Pln | |
| BLDpharm | 250mg | 153.30 Pln | |
| BLDpharm | 1g | 169.96 Pln | |
| BLDpharm | 5g | 325.47 Pln | |
| BLDpharm | 10g | 447.64 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
1-[[4-[4-[(2-hydroxynaphthalen-1-yl)methylideneamino]-3-methylphenyl]-2-methylphenyl]iminomethyl]naphthalen-2-ol (CAS 16196-97-7) is a chemical compound with the molecular formula C36H28N2O2 and a molecular weight of 520.6 g/mol. IUPAC name: 1-[[4-[4-[(2-hydroxynaphthalen-1-yl)methylideneamino]-3-methylphenyl]-2-methylphenyl]iminomethyl]naphthalen-2-ol. InChIKey: KEYZZKYBKUHHMQ-UHFFFAOYSA-N.
| Molecular formula | C36H28N2O2 |
|---|---|
| Molecular weight | 520.6 g/mol |
| IUPAC name | 1-[[4-[4-[(2-hydroxynaphthalen-1-yl)methylideneamino]-3-methylphenyl]-2-methylphenyl]iminomethyl]naphthalen-2-ol |
| InChIKey | KEYZZKYBKUHHMQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=CC(=C(C=C2)N=CC3=C(C=CC4=CC=CC=C43)O)C)N=CC5=C(C=CC6=CC=CC=C65)O |
Computed by PubChem (NCBI)
Synonyms:
CBDivE_003790, s11176