cas: 2519-16-6 — see every product listed under this CAS number, including other names
1,1'-Biphenyl, 4,4'-diphenoxy-, 97%, 97% (CAS 2519-16-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JRE1-250mg |
| cas | 2519-16-6 |
| size | 250mg |
| availability | 8.05g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 923.60 Pln | |
| Chemat | 1g | 1782.80 Pln | |
| Chemat | 5g | 5574.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-phenoxy-4-(4-phenoxyphenyl)benzene (CAS 2519-16-6) is a chemical compound with the molecular formula C24H18O2 and a molecular weight of 338.4 g/mol. IUPAC name: 1-phenoxy-4-(4-phenoxyphenyl)benzene. InChIKey: RGCAQUUSBHVLJD-UHFFFAOYSA-N.
| Molecular formula | C24H18O2 |
|---|---|
| Molecular weight | 338.4 g/mol |
| IUPAC name | 1-phenoxy-4-(4-phenoxyphenyl)benzene |
| InChIKey | RGCAQUUSBHVLJD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)C3=CC=C(C=C3)OC4=CC=CC=C4 |
Computed by PubChem (NCBI)