cas: 646054-51-5 — see every product listed under this CAS number, including other names
1,1'-Biphenyl, 4-fluoro-4'-nitro-3-(trifluoromethyl)-, 95%, 95% (CAS 646054-51-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EKLK-250mg |
| cas | 646054-51-5 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 246.80 Pln | |
| Chemat | 1g | 563.60 Pln | |
| Chemat | 5g | 2066.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-fluoro-4-(4-nitrophenyl)-2-(trifluoromethyl)benzene (CAS 646054-51-5) is a chemical compound with the molecular formula C13H7F4NO2 and a molecular weight of 285.19 g/mol. IUPAC name: 1-fluoro-4-(4-nitrophenyl)-2-(trifluoromethyl)benzene. InChIKey: BXRVWNWNFBLHPD-UHFFFAOYSA-N.
| Molecular formula | C13H7F4NO2 |
|---|---|
| Molecular weight | 285.19 g/mol |
| IUPAC name | 1-fluoro-4-(4-nitrophenyl)-2-(trifluoromethyl)benzene |
| InChIKey | BXRVWNWNFBLHPD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=C(C=C2)F)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)