cas: 2145-68-8 — see every product listed under this CAS number, including other names
1,1,1,2,2-Pentafluoro-6,6-dimethyl-3,5-heptane-dione (CAS 2145-68-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F006960-1G |
| cas | 2145-68-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 227.02 Pln | |
| Fluorochem | 5g | 737.26 Pln |
| delivery time | 2-3 weeks |
|---|
1,1,1,2,2-pentafluoro-6,6-dimethylheptane-3,5-dione (CAS 2145-68-8) is a chemical compound with the molecular formula C9H11F5O2 and a molecular weight of 246.17 g/mol. IUPAC name: 1,1,1,2,2-pentafluoro-6,6-dimethylheptane-3,5-dione. InChIKey: FTTQCEGWFGHNDU-UHFFFAOYSA-N.
| Molecular formula | C9H11F5O2 |
|---|---|
| Molecular weight | 246.17 g/mol |
| IUPAC name | 1,1,1,2,2-pentafluoro-6,6-dimethylheptane-3,5-dione |
| InChIKey | FTTQCEGWFGHNDU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)CC(=O)C(C(F)(F)F)(F)F |
Computed by PubChem (NCBI)