cas: 1605331-75-6 — see every product listed under this CAS number, including other names
1,1,1-Trifluoro-N-(3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)methanesulfonamide, 95%, 95% (CAS 1605331-75-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EHYE-250mg |
| cas | 1605331-75-6 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 1096.40 Pln | |
| Chemat | 1g | 2680.40 Pln | |
| Chemat | 5g | 7504.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1,1,1-trifluoro-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanesulfonamide (CAS 1605331-75-6) is a chemical compound with the molecular formula C13H17BF3NO4S and a molecular weight of 351.2 g/mol. IUPAC name: 1,1,1-trifluoro-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanesulfonamide. InChIKey: RBFSYFCTXISCML-UHFFFAOYSA-N.
| Molecular formula | C13H17BF3NO4S |
|---|---|
| Molecular weight | 351.2 g/mol |
| IUPAC name | 1,1,1-trifluoro-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanesulfonamide |
| InChIKey | RBFSYFCTXISCML-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)NS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)