CAS 21050-13-5 appears in our catalog under these names: Bis(triphenylphosphoranylidene)ammonium Chloride, Bis(triphenylphosphoranylidene)ammonium chloride, Bis(triphenylphosphoranylidene)ammonium chloride, 97% (dry w, Bis(triphenylphosphoranylidene)ammonium Chloride, >98.0%(HPLC), Bis(triphenylphosphine)iminium chloride, 95%, 95%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Chemat. Available pack sizes: 5g, 100g, 25g, 1g, 5kg, 10G, 250G, 50G.
Triphenyl-[(triphenyl-lambda5-phosphanylidene)amino]phosphanium chloride (CAS 21050-13-5) is a chemical compound with the molecular formula C36H30ClNP2 and a molecular weight of 574.0 g/mol. IUPAC name: triphenyl-[(triphenyl-lambda5-phosphanylidene)amino]phosphanium chloride. InChIKey: LVRCYPYRKNAAMX-UHFFFAOYSA-M.
| Molecular formula | C36H30ClNP2 |
|---|---|
| Molecular weight | 574.0 g/mol |
| IUPAC name | triphenyl-[(triphenyl-lambda5-phosphanylidene)amino]phosphanium chloride |
| InChIKey | LVRCYPYRKNAAMX-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)P(=N[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=CC=C6.[Cl-] |
Computed by PubChem (NCBI)