cas: 164861-52-3 — see every product listed under this CAS number, including other names
1,1,3,3-Tetramethyl-2-(4-oxobenzo[d][1,2,3]triazin-3(4H)-yl)uronium hexafluorophosphate(V) 98% (CAS 164861-52-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A721338-1g |
| cas | 164861-52-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 25g | 303.62 Pln | |
| Ambeed | 100g | 782.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A721338 |
[dimethylamino-[(4-oxo-1,2,3-benzotriazin-3-yl)oxy]methylidene]-dimethylazanium hexafluorophosphate (CAS 164861-52-3) is a chemical compound with the molecular formula C12H16F6N5O2P and a molecular weight of 407.25 g/mol. IUPAC name: [dimethylamino-[(4-oxo-1,2,3-benzotriazin-3-yl)oxy]methylidene]-dimethylazanium hexafluorophosphate. InChIKey: QGYDGCPRFFOXLW-UHFFFAOYSA-N.
| Molecular formula | C12H16F6N5O2P |
|---|---|
| Molecular weight | 407.25 g/mol |
| IUPAC name | [dimethylamino-[(4-oxo-1,2,3-benzotriazin-3-yl)oxy]methylidene]-dimethylazanium hexafluorophosphate |
| InChIKey | QGYDGCPRFFOXLW-UHFFFAOYSA-N |
| SMILES | CN(C)C(=[N+](C)C)ON1C(=O)C2=CC=CC=C2N=N1.F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)