1,1,4,4,7,7,10,10-Octamethyl-2,3,4,7,8,9,10,12-octahydro-1H-dibenzo[b,h]fluorene, 97%
cas: 77308-48-6 — see every product listed under this CAS number, including other names
1,1,4,4,7,7,10,10-Octamethyl-2,3,4,7,8,9,10,12-octahydro-1H-dibenzo[b,h]fluorene, 97% (CAS 77308-48-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F229680-250MG |
| cas | 77308-48-6 |
| size | 250mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 112.48 Pln | |
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 393.63 Pln | |
| Fluorochem | 10g | 404.04 Pln | |
| Fluorochem | 25g | 508.17 Pln | |
| Fluorochem | 100g | 1185.02 Pln | |
| Fluorochem | 500g | 3934.05 Pln | |
| Fluorochem | 1kg | 6360.28 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 146.00 Pln | |
| Chemat | 10g | 198.80 Pln | |
| Chemat | 25g | 338.00 Pln | |
| Chemat | 50g | 578.00 Pln | |
| Chemat | 100g | 918.80 Pln | |
| Chemat | 500g | 3086.40 Pln | |
| Chemat | 1kg | 5085.20 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
5,5,8,8,16,16,19,19-octamethylpentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),10,13,15(20)-hexaene (CAS 77308-48-6) is a chemical compound with the molecular formula C29H38 and a molecular weight of 386.6 g/mol. IUPAC name: 5,5,8,8,16,16,19,19-octamethylpentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),10,13,15(20)-hexaene. InChIKey: JFZKLFKSJQUIBS-UHFFFAOYSA-N.
| Molecular formula | C29H38 |
|---|---|
| Molecular weight | 386.6 g/mol |
| IUPAC name | 5,5,8,8,16,16,19,19-octamethylpentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),10,13,15(20)-hexaene |
| InChIKey | JFZKLFKSJQUIBS-UHFFFAOYSA-N |
| SMILES | CC1(CCC(C2=C1C=C3CC4=CC5=C(C=C4C3=C2)C(CCC5(C)C)(C)C)(C)C)C |
Computed by PubChem (NCBI)
Synonyms:
1,1,4,4,7,7,10,10-Octamethyl-2,3,4,7,8,9,10,12-octahydro-1H-dibenzo[b,h]fluorene, 1,2,3,4,7,8,9,10-Octahydro-1,1,4,4,7,7,10,10-octamethyl-1H-Dibenzo[b,h]fluorene, octamethyldibenzofluorene, 1,1,4,4,7,7,10,10-Octamethyl-2,3,4,7,8,9, JFZKLFKSJQUIBS-UHFFFAOYSA-N, 1,1,4,4,7,7,10,10-octamethyl- 1,2,3,4,7,8,9,10- octahydrodibenzo[b,h]fluorene, 1,1,4,4,7,7,10,10-octamethyl-1,2,3,4,7,8,9,10-octahydrodibenzo(b,h)-fluorene, 1,1,4,4,7,7,10,10-OctaMethyl-2,3,4,5,7,8,9,10-octahydro-1H-dibenzo[b,h]fluorene