cas: 1611468-28-0 — see every product listed under this CAS number, including other names
1,1′-Bis(1,1-dimethylethyl) 3,3′-[1,2-ethanediylbis(oxy)]bis[propanoate], 95%, 95% (CAS 1611468-28-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HYNE-250mg |
| cas | 1611468-28-0 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 1154.00 Pln | |
| Chemat | 1g | 2243.60 Pln | |
| Chemat | 5g | 6909.20 Pln | |
| Chemat | 10g | 11018.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]propanoate (CAS 1611468-28-0) is a chemical compound with the molecular formula C16H30O6 and a molecular weight of 318.41 g/mol. IUPAC name: tert-butyl 3-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]propanoate. InChIKey: ALKAASHAFVQEJO-UHFFFAOYSA-N.
| Molecular formula | C16H30O6 |
|---|---|
| Molecular weight | 318.41 g/mol |
| IUPAC name | tert-butyl 3-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]propanoate |
| InChIKey | ALKAASHAFVQEJO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)