cas: 1807539-02-1 — see every product listed under this CAS number, including other names
1,1′-Bis(2,3,4,5,6-pentafluorophenyl) 3,3′-oxybis[propanoate], 95%, 95% (CAS 1807539-02-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I103-100mg |
| cas | 1807539-02-1 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 443.60 Pln | |
| Chemat | 250mg | 794.00 Pln | |
| Chemat | 1g | 1965.20 Pln | |
| Chemat | 5g | 8502.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2,3,4,5,6-pentafluorophenyl) 3-[3-oxo-3-(2,3,4,5,6-pentafluorophenoxy)propoxy]propanoate (CAS 1807539-02-1) is a chemical compound with the molecular formula C18H8F10O5 and a molecular weight of 494.2 g/mol. IUPAC name: (2,3,4,5,6-pentafluorophenyl) 3-[3-oxo-3-(2,3,4,5,6-pentafluorophenoxy)propoxy]propanoate. InChIKey: PACGANKFUNUYHE-UHFFFAOYSA-N.
| Molecular formula | C18H8F10O5 |
|---|---|
| Molecular weight | 494.2 g/mol |
| IUPAC name | (2,3,4,5,6-pentafluorophenyl) 3-[3-oxo-3-(2,3,4,5,6-pentafluorophenoxy)propoxy]propanoate |
| InChIKey | PACGANKFUNUYHE-UHFFFAOYSA-N |
| SMILES | C(COCCC(=O)OC1=C(C(=C(C(=C1F)F)F)F)F)C(=O)OC2=C(C(=C(C(=C2F)F)F)F)F |
Computed by PubChem (NCBI)