cas: 1807539-01-0 — see every product listed under this CAS number, including other names
1,1-Dimethylethyl 14-[[(4-methylphenyl)sulfonyl]oxy]-3,6,9,12-tetraoxa-2-azatetradecanoate, 98%, 98% (CAS 1807539-01-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I102-100mg |
| cas | 1807539-01-0 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 827.60 Pln | |
| Chemat | 250mg | 1374.80 Pln | |
| Chemat | 500mg | 2363.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]oxyethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate (CAS 1807539-01-0) is a chemical compound with the molecular formula C20H33NO9S and a molecular weight of 463.5 g/mol. IUPAC name: 2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]oxyethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate. InChIKey: ILJUQOOWAYCBJG-UHFFFAOYSA-N.
| Molecular formula | C20H33NO9S |
|---|---|
| Molecular weight | 463.5 g/mol |
| IUPAC name | 2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]oxyethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
| InChIKey | ILJUQOOWAYCBJG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCCOCCONC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)