CAS 15570-45-3 appears in our catalog under these names: 1,2,3,4-Tetraphenyl-1,3-cyclopentadiene, 95%, 1,2,3,4-Tetraphenyl-1,3-cyclopentadiene, 98%, 1,2,3,4–Tetraphenyl–1,3–cyclopentadiene, 1,2,3,4-Tetraphenyl-1,3-cyclopentadiene, >98.0%(GC), 1,2,3,4-TETRAPHENYL-1,3-CYCLOPENTADIENE&. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Sigma-Aldrich. Available pack sizes: 5g, 1g, 250mg, 100mg.
(2,3,4-triphenylcyclopenta-1,3-dien-1-yl)benzene (CAS 15570-45-3) is a chemical compound with the molecular formula C29H22 and a molecular weight of 370.5 g/mol. IUPAC name: (2,3,4-triphenylcyclopenta-1,3-dien-1-yl)benzene. InChIKey: JCXLYAWYOTYWKM-UHFFFAOYSA-N.
| Molecular formula | C29H22 |
|---|---|
| Molecular weight | 370.5 g/mol |
| IUPAC name | (2,3,4-triphenylcyclopenta-1,3-dien-1-yl)benzene |
| InChIKey | JCXLYAWYOTYWKM-UHFFFAOYSA-N |
| SMILES | C1C(=C(C(=C1C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)