CAS 67815-57-0 appears in our catalog under these names: 1,3-Diiodotetrafluorobenzene, 95%, 1,3-Diiodotetrafluorobenzene, 1,2,3,5-Tetrafluoro-4,6-diiodobenzene, 95%, 95%. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 5g, 100g, 25g, 1g, 100mg, 250mg, 10g.
1,2,3,5-tetrafluoro-4,6-diiodobenzene (CAS 67815-57-0) is a chemical compound with the molecular formula C6F4I2 and a molecular weight of 401.87 g/mol. IUPAC name: 1,2,3,5-tetrafluoro-4,6-diiodobenzene. InChIKey: FVJBAXUUZIEJCB-UHFFFAOYSA-N.
| Molecular formula | C6F4I2 |
|---|---|
| Molecular weight | 401.87 g/mol |
| IUPAC name | 1,2,3,5-tetrafluoro-4,6-diiodobenzene |
| InChIKey | FVJBAXUUZIEJCB-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)I)F)I)F)F |
Computed by PubChem (NCBI)