cas: 447463-65-2 — see every product listed under this CAS number, including other names
1,2,4,5-Tetrakis(tert-butylthio)benzene, 97%, 97% (CAS 447463-65-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 250mg, 1g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114DAX-5g |
| cas | 447463-65-2 |
| size | 5g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 390.80 Pln | |
| Chemat | 25g | 1691.60 Pln | |
| Chemat | 100g | 6587.60 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 10g | 712.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1,2,4,5-tetrakis(tert-butylsulfanyl)benzene (CAS 447463-65-2) is a chemical compound with the molecular formula C22H38S4 and a molecular weight of 430.8 g/mol. IUPAC name: 1,2,4,5-tetrakis(tert-butylsulfanyl)benzene. InChIKey: LOCUYYPERSWXJI-UHFFFAOYSA-N.
| Molecular formula | C22H38S4 |
|---|---|
| Molecular weight | 430.8 g/mol |
| IUPAC name | 1,2,4,5-tetrakis(tert-butylsulfanyl)benzene |
| InChIKey | LOCUYYPERSWXJI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)SC1=CC(=C(C=C1SC(C)(C)C)SC(C)(C)C)SC(C)(C)C |
Computed by PubChem (NCBI)