cas: 22952-20-1 — see every product listed under this CAS number, including other names
1,2-BENZISOTHIAZOL-3(2H)-ONE, 5-NITRO-, 1,1-DIOXIDE, 97% (CAS 22952-20-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F533468-100MG |
| cas | 22952-20-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 784.12 Pln | |
| Fluorochem | 250mg | 1283.94 Pln | |
| Fluorochem | 1g | 3371.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
5-nitro-1,1-dioxo-1,2-benzothiazol-3-one (CAS 22952-20-1) is a chemical compound with the molecular formula C7H4N2O5S and a molecular weight of 228.18 g/mol. IUPAC name: 5-nitro-1,1-dioxo-1,2-benzothiazol-3-one. InChIKey: KABUZPWVPGUDIR-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O5S |
|---|---|
| Molecular weight | 228.18 g/mol |
| IUPAC name | 5-nitro-1,1-dioxo-1,2-benzothiazol-3-one |
| InChIKey | KABUZPWVPGUDIR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])C(=O)NS2(=O)=O |
Computed by PubChem (NCBI)