CAS 199166-26-2 is the registry number for 1,2-Bis(4-(trifluoromethyl)phenyl)ethane-1,2-diol, 97%, 97%. Offered by: Chemat. Available pack sizes: 250mg.
1,2-bis[4-(trifluoromethyl)phenyl]ethane-1,2-diol (CAS 199166-26-2) is a chemical compound with the molecular formula C16H12F6O2 and a molecular weight of 350.25 g/mol. IUPAC name: 1,2-bis[4-(trifluoromethyl)phenyl]ethane-1,2-diol. InChIKey: DIPRJPNCVRBSTA-UHFFFAOYSA-N.
| Molecular formula | C16H12F6O2 |
|---|---|
| Molecular weight | 350.25 g/mol |
| IUPAC name | 1,2-bis[4-(trifluoromethyl)phenyl]ethane-1,2-diol |
| InChIKey | DIPRJPNCVRBSTA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(C2=CC=C(C=C2)C(F)(F)F)O)O)C(F)(F)F |
Computed by PubChem (NCBI)