1,2-Dioleoyl-3-trimethylammonium propane chloride, 98%, 98%
cas: 132172-61-3 — see every product listed under this CAS number, including other names
1,2-Dioleoyl-3-trimethylammonium propane chloride, 98%, 98% (CAS 132172-61-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 50g, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1121CO-10g |
| cas | 132172-61-3 |
| size | 10g |
| availability | 50g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 6698.00 Pln | |
| Chemat | 25g | 12237.20 Pln | |
| Chemat | 50g | 16298.00 Pln | |
| Chemat | 25mg | 198.80 Pln | |
| Chemat | 50mg | 333.20 Pln | |
| Chemat | 100mg | 582.80 Pln | |
| Chemat | 250mg | 875.60 Pln | |
| Chemat | 1g | 2181.20 Pln | |
| Chemat | 5g | 5781.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl-trimethylazanium chloride (CAS 132172-61-3) is a chemical compound with the molecular formula C42H80ClNO4 and a molecular weight of 698.5 g/mol. IUPAC name: 2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl-trimethylazanium chloride. InChIKey: KSXTUUUQYQYKCR-LQDDAWAPSA-M.
| Molecular formula | C42H80ClNO4 |
|---|---|
| Molecular weight | 698.5 g/mol |
| IUPAC name | 2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl-trimethylazanium chloride |
| InChIKey | KSXTUUUQYQYKCR-LQDDAWAPSA-M |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(C[N+](C)(C)C)OC(=O)CCCCCCC/C=C\CCCCCCCC.[Cl-] |
Computed by PubChem (NCBI)
Synonyms:
Dotap chloride, N-(1-(2,3-Dioleoyloxy)propyl)-N,N,N-trimethylammonium chloride, (+-)-DOTAP CHLORIDE, DOTAP CHLORIDE, (+-)-, 1,2-Dioleoyl-3-trimethylammonium-propane, Chloride, DOTAP (chloride), (+/-)-Dotap chloride, Dotap chloride, (+/-)-, N,N,N-Trimethyl-2,3-bis(oleoyloxy)propan-1-aminium chloride, DOTAP (chloride) (Excipient)