cas: 2121513-92-4 — see every product listed under this CAS number, including other names
1,3,2-Dioxaborolane, 2-[3,5-dimethyl-4-(phenylmethoxy)phenyl]-4,4,5,5-tetramethyl-, 97%, 97% (CAS 2121513-92-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EHMT-250mg |
| cas | 2121513-92-4 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 434.00 Pln | |
| Chemat | 5g | 1192.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(3,5-dimethyl-4-phenylmethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121513-92-4) is a chemical compound with the molecular formula C21H27BO3 and a molecular weight of 338.2 g/mol. IUPAC name: 2-(3,5-dimethyl-4-phenylmethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: OYZFBHUJAVTFEF-UHFFFAOYSA-N.
| Molecular formula | C21H27BO3 |
|---|---|
| Molecular weight | 338.2 g/mol |
| IUPAC name | 2-(3,5-dimethyl-4-phenylmethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | OYZFBHUJAVTFEF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)C)OCC3=CC=CC=C3)C |
Computed by PubChem (NCBI)