1,3,2-Dioxaborolane, 2-[3-[(3-fluorophenoxy)methyl]phenyl]-4,4,5,5-tetramethyl-, 97%, 97%
cas: 1648930-12-4 — see every product listed under this CAS number, including other names
1,3,2-Dioxaborolane, 2-[3-[(3-fluorophenoxy)methyl]phenyl]-4,4,5,5-tetramethyl-, 97%, 97% (CAS 1648930-12-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FFWY-100mg |
| cas | 1648930-12-4 |
| size | 100mg |
| availability | 4.35g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 194.00 Pln | |
| Chemat | 250mg | 352.40 Pln | |
| Chemat | 1g | 1154.00 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-[3-[(3-fluorophenoxy)methyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1648930-12-4) is a chemical compound with the molecular formula C19H22BFO3 and a molecular weight of 328.2 g/mol. IUPAC name: 2-[3-[(3-fluorophenoxy)methyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: FXURVMGDDYIRGC-UHFFFAOYSA-N.
| Molecular formula | C19H22BFO3 |
|---|---|
| Molecular weight | 328.2 g/mol |
| IUPAC name | 2-[3-[(3-fluorophenoxy)methyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | FXURVMGDDYIRGC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)COC3=CC(=CC=C3)F |
Computed by PubChem (NCBI)
Synonyms:
1,3,2-Dioxaborolane, 2-[3-[(3-fluorophenoxy)methyl]phenyl]-4,4,5,5-tetramethyl-, 2-(3-((3-Fluorophenoxy)methyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-[3-[(3-fluorophenoxy)methyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-{3-[(3-fluorophenoxy)methyl]phenyl}-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, [3-[(3-Fluorophenoxy)methyl]phenyl]boronic acid pinacol ester