cas: 2246740-41-8 — see every product listed under this CAS number, including other names
1,3,2-Dioxaborolane, 2-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-4,4,5,5-tetramethyl-, 95%, 95% (CAS 2246740-41-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FFWZ-250mg |
| cas | 2246740-41-8 |
| size | 250mg |
| availability | 8.11g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 410.00 Pln | |
| Chemat | 1g | 794.00 Pln | |
| Chemat | 5g | 2498.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2246740-41-8) is a chemical compound with the molecular formula C19H21BCl2O3 and a molecular weight of 379.1 g/mol. IUPAC name: 2-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: MUYVYQGFNDSBCP-UHFFFAOYSA-N.
| Molecular formula | C19H21BCl2O3 |
|---|---|
| Molecular weight | 379.1 g/mol |
| IUPAC name | 2-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | MUYVYQGFNDSBCP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OCC3=CC(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)