cas: 727-49-1 — see every product listed under this CAS number, including other names
1,3,4,5,6,7,8-Heptafluoronaphthalen-2-ol, 95%, 95% (CAS 727-49-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1173BN-100mg |
| cas | 727-49-1 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 314.00 Pln | |
| Chemat | 250mg | 563.60 Pln | |
| Chemat | 1g | 1274.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1,3,4,5,6,7,8-heptafluoronaphthalen-2-ol (CAS 727-49-1) is a chemical compound with the molecular formula C10HF7O and a molecular weight of 270.10 g/mol. IUPAC name: 1,3,4,5,6,7,8-heptafluoronaphthalen-2-ol. InChIKey: RWEQEWKAJFTONV-UHFFFAOYSA-N.
| Molecular formula | C10HF7O |
|---|---|
| Molecular weight | 270.10 g/mol |
| IUPAC name | 1,3,4,5,6,7,8-heptafluoronaphthalen-2-ol |
| InChIKey | RWEQEWKAJFTONV-UHFFFAOYSA-N |
| SMILES | C12=C(C(=C(C(=C1F)O)F)F)C(=C(C(=C2F)F)F)F |
Computed by PubChem (NCBI)