cas: 141510-66-9 — see every product listed under this CAS number, including other names
1,3,4,6-Tetra-O-acetyl-2-deoxy-2-iodo-β-D-galactopyranose (CAS 141510-66-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM37290C-100mg |
| cas | 141510-66-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 2176.48 Pln | |
| Chemat | 1g | 12262.56 Pln | |
| Chemat | 250mg | 4104.16 Pln | |
| Chemat | 500mg | 6824.41 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | no data |
| category | Chemicals |
[(2R,3S,4S,5R,6S)-3,4,6-triacetyloxy-5-iodooxan-2-yl]methyl acetate (CAS 141510-66-9) is a chemical compound with the molecular formula C14H19IO9 and a molecular weight of 458.20 g/mol. IUPAC name: [(2R,3S,4S,5R,6S)-3,4,6-triacetyloxy-5-iodooxan-2-yl]methyl acetate. InChIKey: KXQRSYVDKIOQHJ-RKQHYHRCSA-N.
| Molecular formula | C14H19IO9 |
|---|---|
| Molecular weight | 458.20 g/mol |
| IUPAC name | [(2R,3S,4S,5R,6S)-3,4,6-triacetyloxy-5-iodooxan-2-yl]methyl acetate |
| InChIKey | KXQRSYVDKIOQHJ-RKQHYHRCSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)OC(=O)C)I)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)