cas: 10353-00-1 — see every product listed under this CAS number, including other names
1,3,4,6-Tetra-O-acetyl-2-deoxy-2-trichloroacetylamino-β-D-glucopyranose (CAS 10353-00-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 2g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM29740C-10g |
| cas | 10353-00-1 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 7565.18 Pln | |
| Chemat | 1g | 1682.15 Pln | |
| Chemat | 2g | 2422.92 Pln | |
| Chemat | 5g | 4598.01 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | no data |
| category | Chemicals |
[3,4,6-triacetyloxy-5-[(2,2,2-trichloroacetyl)amino]oxan-2-yl]methyl acetate (CAS 10353-00-1) is a chemical compound with the molecular formula C16H20Cl3NO10 and a molecular weight of 492.7 g/mol. IUPAC name: [3,4,6-triacetyloxy-5-[(2,2,2-trichloroacetyl)amino]oxan-2-yl]methyl acetate. InChIKey: SEEYXQVYXYGHNF-UHFFFAOYSA-N.
| Molecular formula | C16H20Cl3NO10 |
|---|---|
| Molecular weight | 492.7 g/mol |
| IUPAC name | [3,4,6-triacetyloxy-5-[(2,2,2-trichloroacetyl)amino]oxan-2-yl]methyl acetate |
| InChIKey | SEEYXQVYXYGHNF-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC1C(C(C(C(O1)OC(=O)C)NC(=O)C(Cl)(Cl)Cl)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)