CAS 133546-43-7 is the registry number for 1,3,5,7-Tetrabromonaphthalene-2,6-diol, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
1,3,5,7-tetrabromonaphthalene-2,6-diol (CAS 133546-43-7) is a chemical compound with the molecular formula C10H4Br4O2 and a molecular weight of 475.75 g/mol. IUPAC name: 1,3,5,7-tetrabromonaphthalene-2,6-diol. InChIKey: ZQPBPAPLDFPASW-UHFFFAOYSA-N.
| Molecular formula | C10H4Br4O2 |
|---|---|
| Molecular weight | 475.75 g/mol |
| IUPAC name | 1,3,5,7-tetrabromonaphthalene-2,6-diol |
| InChIKey | ZQPBPAPLDFPASW-UHFFFAOYSA-N |
| SMILES | C1=C2C(=C(C(=C1Br)O)Br)C=C(C(=C2Br)O)Br |
Computed by PubChem (NCBI)