cas: 13001-29-1 — see every product listed under this CAS number, including other names
1,3,5-Trichloro-2-(2-chloroethoxy)benzene, 95%, 95% (CAS 13001-29-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111TWP-1g |
| cas | 13001-29-1 |
| size | 1g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 213.20 Pln | |
| Chemat | 25g | 438.80 Pln | |
| Chemat | 100g | 1154.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1,3,5-trichloro-2-(2-chloroethoxy)benzene (CAS 13001-29-1) is a chemical compound with the molecular formula C8H6Cl4O and a molecular weight of 259.9 g/mol. IUPAC name: 1,3,5-trichloro-2-(2-chloroethoxy)benzene. InChIKey: YNJGVSWHTYTTDC-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl4O |
|---|---|
| Molecular weight | 259.9 g/mol |
| IUPAC name | 1,3,5-trichloro-2-(2-chloroethoxy)benzene |
| InChIKey | YNJGVSWHTYTTDC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)OCCCl)Cl)Cl |
Computed by PubChem (NCBI)