cas: 118688-56-5 — see every product listed under this CAS number, including other names
1,3,5-Tris(phenylethynyl)benzene 95% (CAS 118688-56-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A383699-10g |
| cas | 118688-56-5 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 2083.62 Pln | |
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 1143.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A383699 |
1,3,5-tris(2-phenylethynyl)benzene (CAS 118688-56-5) is a chemical compound with the molecular formula C30H18 and a molecular weight of 378.5 g/mol. IUPAC name: 1,3,5-tris(2-phenylethynyl)benzene. InChIKey: YUOGUVUAZGQYFR-UHFFFAOYSA-N.
| Molecular formula | C30H18 |
|---|---|
| Molecular weight | 378.5 g/mol |
| IUPAC name | 1,3,5-tris(2-phenylethynyl)benzene |
| InChIKey | YUOGUVUAZGQYFR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C#CC2=CC(=CC(=C2)C#CC3=CC=CC=C3)C#CC4=CC=CC=C4 |
Computed by PubChem (NCBI)