cas: 122546-74-1 — see every product listed under this CAS number, including other names
1,3-Benzenedicarbonitrile, 2,5-difluoro-, 95%, 95% (CAS 122546-74-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1128FH-100mg |
| cas | 122546-74-1 |
| size | 100mg |
| availability | 5.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 386.00 Pln | |
| Chemat | 250mg | 530.00 Pln | |
| Chemat | 1g | 1096.40 Pln | |
| Chemat | 5g | 3165.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2,5-difluorobenzene-1,3-dicarbonitrile (CAS 122546-74-1) is a chemical compound with the molecular formula C8H2F2N2 and a molecular weight of 164.11 g/mol. IUPAC name: 2,5-difluorobenzene-1,3-dicarbonitrile. InChIKey: MWGSTFSKJGWSGR-UHFFFAOYSA-N.
| Molecular formula | C8H2F2N2 |
|---|---|
| Molecular weight | 164.11 g/mol |
| IUPAC name | 2,5-difluorobenzene-1,3-dicarbonitrile |
| InChIKey | MWGSTFSKJGWSGR-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C#N)F)C#N)F |
Computed by PubChem (NCBI)