cas: 6737-42-4 — see every product listed under this CAS number, including other names
1,3-Bis(diphenylphosphino)propane, 95% (CAS 6737-42-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g, 10g, 25g, 50g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F079469-100MG |
| cas | 6737-42-4 |
| size | 100mg |
| availability | In Stock Germany |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 102.07 Pln | |
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 10g | 107.27 Pln | |
| Fluorochem | 25g | 117.68 Pln | |
| Fluorochem | 50g | 180.16 Pln | |
| Fluorochem | 100g | 216.61 Pln | |
| Fluorochem | 500g | 758.08 Pln | |
| Fluorochem | 1kg | 1450.55 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
3-diphenylphosphanylpropyl(diphenyl)phosphane (CAS 6737-42-4) is a chemical compound with the molecular formula C27H26P2 and a molecular weight of 412.4 g/mol. IUPAC name: 3-diphenylphosphanylpropyl(diphenyl)phosphane. InChIKey: LVEYOSJUKRVCCF-UHFFFAOYSA-N.
| Molecular formula | C27H26P2 |
|---|---|
| Molecular weight | 412.4 g/mol |
| IUPAC name | 3-diphenylphosphanylpropyl(diphenyl)phosphane |
| InChIKey | LVEYOSJUKRVCCF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(CCCP(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)